C13H24N6O2 — CID 106229672
2-[4-(1-aminobutyl)triazol-1-yl]-N-(tert-butylcarbamoyl)acetamide (PubChem CID 106229672) has the molecular formula C13H24N6O2 and a molecular weight of 296.38 g/mol. Its IUPAC name is 2-[4-(1-aminobutyl)triazol-1-yl]-N-(tert-butylcarbamoyl)acetamide.
| Compound Name | 2-[4-(1-aminobutyl)triazol-1-yl]-N-(tert-butylcarbamoyl)acetamide |
|---|---|
| PubChem CID | 106229672 |
| Molecular Formula | C13H24N6O2 |
| Molecular Weight | 296.38 g/mol |
| Exact Mass | 296.20 |
| IUPAC Name | 2-[4-(1-aminobutyl)triazol-1-yl]-N-(tert-butylcarbamoyl)acetamide |
| SMILES | CCCC(N)c1cn(CC(=O)NC(=O)NC(C)(C)C)nn1 |
| InChI | InChI=1S/C13H24N6O2/c1-5-6-9(14)10-7-19(18-17-10)8-11(20)15-12(21)16-13(2,3)4/h7,9H,5-6,8,14H2,1-4H3,(H2,15,16,20,21) |
| InChIKey | DIMBLJLXXYEFPV-UHFFFAOYSA-N |
| XLogP | 0.70 |
| TPSA | 114.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.38 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |