C11H17N3 — CID 106229374
N-[(2,5-dimethylpyrazol-3-yl)methyl]pent-1-yn-3-amine (PubChem CID 106229374) has the molecular formula C11H17N3 and a molecular weight of 191.28 g/mol. Its IUPAC name is N-[(2,5-dimethylpyrazol-3-yl)methyl]pent-1-yn-3-amine.
| Compound Name | N-[(2,5-dimethylpyrazol-3-yl)methyl]pent-1-yn-3-amine |
|---|---|
| PubChem CID | 106229374 |
| Molecular Formula | C11H17N3 |
| Molecular Weight | 191.28 g/mol |
| Exact Mass | 191.14 |
| IUPAC Name | N-[(2,5-dimethylpyrazol-3-yl)methyl]pent-1-yn-3-amine |
| SMILES | C#CC(CC)NCc1cc(C)nn1C |
| InChI | InChI=1S/C11H17N3/c1-5-10(6-2)12-8-11-7-9(3)13-14(11)4/h1,7,10,12H,6,8H2,2-4H3 |
| InChIKey | QDHCFZOBTPTAHT-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 191.28 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|