C23H30N2O5Si — CID 10623077
2-trimethylsilylethyl (2R,3R)-3-(4-methoxyphenyl)-1-(4-nitrophenyl)pyrrolidine-2-carboxylate (PubChem CID 10623077) has the molecular formula C23H30N2O5Si and a molecular weight of 442.59 g/mol. Its IUPAC name is 2-trimethylsilylethyl (2R,3R)-3-(4-methoxyphenyl)-1-(4-nitrophenyl)pyrrolidine-2-carboxylate.
| Compound Name | 2-trimethylsilylethyl (2R,3R)-3-(4-methoxyphenyl)-1-(4-nitrophenyl)pyrrolidine-2-carboxylate |
|---|---|
| PubChem CID | 10623077 |
| Molecular Formula | C23H30N2O5Si |
| Molecular Weight | 442.59 g/mol |
| Exact Mass | 442.19 |
| IUPAC Name | 2-trimethylsilylethyl (2R,3R)-3-(4-methoxyphenyl)-1-(4-nitrophenyl)pyrrolidine-2-carboxylate |
| SMILES | COc1ccc([C@H]2CCN(c3ccc([N+](=O)[O-])cc3)[C@H]2C(=O)OCC[Si](C)(C)C)cc1 |
| InChI | InChI=1S/C23H30N2O5Si/c1-29-20-11-5-17(6-12-20)21-13-14-24(18-7-9-19(10-8-18)25(27)28)22(21)23(26)30-15-16-31(2,3)4/h5-12,21-22H,13-16H2,1-4H3/t21-,22-/m1/s1 |
| InChIKey | LMWVHPKURFEBML-FGZHOGPDSA-N |
| XLogP | 4.85 |
| TPSA | 81.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.59 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|