C12H14N4 — CID 106231156
7-methyl-N-pent-1-yn-3-yl-[1,2,4]triazolo[1,5-a]pyridin-2-amine (PubChem CID 106231156) has the molecular formula C12H14N4 and a molecular weight of 214.27 g/mol. Its IUPAC name is 7-methyl-N-pent-1-yn-3-yl-[1,2,4]triazolo[1,5-a]pyridin-2-amine.
| Compound Name | 7-methyl-N-pent-1-yn-3-yl-[1,2,4]triazolo[1,5-a]pyridin-2-amine |
|---|---|
| PubChem CID | 106231156 |
| Molecular Formula | C12H14N4 |
| Molecular Weight | 214.27 g/mol |
| Exact Mass | 214.12 |
| IUPAC Name | 7-methyl-N-pent-1-yn-3-yl-[1,2,4]triazolo[1,5-a]pyridin-2-amine |
| SMILES | C#CC(CC)Nc1nc2cc(C)ccn2n1 |
| InChI | InChI=1S/C12H14N4/c1-4-10(5-2)13-12-14-11-8-9(3)6-7-16(11)15-12/h1,6-8,10H,5H2,2-3H3,(H,13,15) |
| InChIKey | KAXAENZMNWPOPT-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 42.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.27 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|