C7H9N5 — CID 116989782
(7-methyl-[1,2,4]triazolo[1,5-a]pyridin-2-yl)hydrazine (PubChem CID 116989782) has the molecular formula C7H9N5 and a molecular weight of 163.18 g/mol. Its IUPAC name is (7-methyl-[1,2,4]triazolo[1,5-a]pyridin-2-yl)hydrazine.
| Compound Name | (7-methyl-[1,2,4]triazolo[1,5-a]pyridin-2-yl)hydrazine |
|---|---|
| PubChem CID | 116989782 |
| Molecular Formula | C7H9N5 |
| Molecular Weight | 163.18 g/mol |
| Exact Mass | 163.09 |
| IUPAC Name | (7-methyl-[1,2,4]triazolo[1,5-a]pyridin-2-yl)hydrazine |
| SMILES | Cc1ccn2nc(NN)nc2c1 |
| InChI | InChI=1S/C7H9N5/c1-5-2-3-12-6(4-5)9-7(10-8)11-12/h2-4H,8H2,1H3,(H,10,11) |
| InChIKey | IPOIZILZQNMHDM-UHFFFAOYSA-N |
| XLogP | 0.32 |
| TPSA | 68.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 163.18 |
| LogP ≤ 5 | 0.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|