C6H6ClN5 — CID 116990287
(7-chloro-[1,2,4]triazolo[1,5-a]pyridin-2-yl)hydrazine (PubChem CID 116990287) has the molecular formula C6H6ClN5 and a molecular weight of 183.60 g/mol. Its IUPAC name is (7-chloro-[1,2,4]triazolo[1,5-a]pyridin-2-yl)hydrazine.
| Compound Name | (7-chloro-[1,2,4]triazolo[1,5-a]pyridin-2-yl)hydrazine |
|---|---|
| PubChem CID | 116990287 |
| Molecular Formula | C6H6ClN5 |
| Molecular Weight | 183.60 g/mol |
| Exact Mass | 183.03 |
| IUPAC Name | (7-chloro-[1,2,4]triazolo[1,5-a]pyridin-2-yl)hydrazine |
| SMILES | NNc1nc2cc(Cl)ccn2n1 |
| InChI | InChI=1S/C6H6ClN5/c7-4-1-2-12-5(3-4)9-6(10-8)11-12/h1-3H,8H2,(H,10,11) |
| InChIKey | VUPYKPGEENOWOU-UHFFFAOYSA-N |
| XLogP | 0.67 |
| TPSA | 68.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 183.60 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|