About 2-benzyl-7-chloro-[1,2,4]triazolo[1,5-a]pyridine
2-benzyl-7-chloro-[1,2,4]triazolo[1,5-a]pyridine (PubChem CID 117134952) has the molecular formula C13H10ClN3
and a molecular weight of 243.70 g/mol. Its IUPAC name is 2-benzyl-7-chloro-[1,2,4]triazolo[1,5-a]pyridine.
Molecular Properties
| Compound Name | 2-benzyl-7-chloro-[1,2,4]triazolo[1,5-a]pyridine |
| PubChem CID | 117134952 |
| Molecular Formula | C13H10ClN3 |
| Molecular Weight | 243.70 g/mol |
| Exact Mass | 243.06 |
| IUPAC Name | 2-benzyl-7-chloro-[1,2,4]triazolo[1,5-a]pyridine |
| SMILES | Clc1ccn2nc(Cc3ccccc3)nc2c1 |
| InChI | InChI=1S/C13H10ClN3/c14-11-6-7-17-13(9-11)15-12(16-17)8-10-4-2-1-3-5-10/h1-7,9H,8H2 |
| InChIKey | WCPKWVVGSOWSEH-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 30.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 243.70 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-benzyl-7-chloro-[1,2,4]triazolo[1,5-a]pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-benzyl-7-chloro-[1,2,4]triazolo[1,5-a]pyridine?
The IUPAC name of 2-benzyl-7-chloro-[1,2,4]triazolo[1,5-a]pyridine (CID 117134952) is 2-benzyl-7-chloro-[1,2,4]triazolo[1,5-a]pyridine.
What is the SMILES notation for 2-benzyl-7-chloro-[1,2,4]triazolo[1,5-a]pyridine?
The canonical SMILES for 2-benzyl-7-chloro-[1,2,4]triazolo[1,5-a]pyridine is Clc1ccn2nc(Cc3ccccc3)nc2c1.
What is the InChIKey of 2-benzyl-7-chloro-[1,2,4]triazolo[1,5-a]pyridine?
The InChIKey is WCPKWVVGSOWSEH-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H10ClN3/c14-11-6-7-17-13(9-11)15-12(16-17)8-10-4-2-1-3-5-10/h1-7,9H,8H2.
What are the key properties of 2-benzyl-7-chloro-[1,2,4]triazolo[1,5-a]pyridine?
2-benzyl-7-chloro-[1,2,4]triazolo[1,5-a]pyridine has a molecular weight of 243.70 g/mol, XLogP of 2.97, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-benzyl-7-chloro-[1,2,4]triazolo[1,5-a]pyridine is sourced from PubChem (CID 117134952), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).