C10H12BrN3O — CID 106231600
5-bromo-4-(hex-1-yn-3-ylamino)-1H-pyridazin-6-one (PubChem CID 106231600) has the molecular formula C10H12BrN3O and a molecular weight of 270.13 g/mol. Its IUPAC name is 5-bromo-4-(hex-1-yn-3-ylamino)-1H-pyridazin-6-one.
| Compound Name | 5-bromo-4-(hex-1-yn-3-ylamino)-1H-pyridazin-6-one |
|---|---|
| PubChem CID | 106231600 |
| Molecular Formula | C10H12BrN3O |
| Molecular Weight | 270.13 g/mol |
| Exact Mass | 269.02 |
| IUPAC Name | 5-bromo-4-(hex-1-yn-3-ylamino)-1H-pyridazin-6-one |
| SMILES | C#CC(CCC)Nc1cn[nH]c(=O)c1Br |
| InChI | InChI=1S/C10H12BrN3O/c1-3-5-7(4-2)13-8-6-12-14-10(15)9(8)11/h2,6-7H,3,5H2,1H3,(H2,13,14,15) |
| InChIKey | HTCBJLKZEUQEJI-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 57.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.13 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|