C15H15Br2N3OS — CID 10623195
2-(2,5-dibromophenyl)-1-methyl-1-(3-methylsulfinylphenyl)guanidine (PubChem CID 10623195) has the molecular formula C15H15Br2N3OS and a molecular weight of 445.18 g/mol. Its IUPAC name is 2-(2,5-dibromophenyl)-1-methyl-1-(3-methylsulfinylphenyl)guanidine.
| Compound Name | 2-(2,5-dibromophenyl)-1-methyl-1-(3-methylsulfinylphenyl)guanidine |
|---|---|
| PubChem CID | 10623195 |
| Molecular Formula | C15H15Br2N3OS |
| Molecular Weight | 445.18 g/mol |
| Exact Mass | 442.93 |
| IUPAC Name | 2-(2,5-dibromophenyl)-1-methyl-1-(3-methylsulfinylphenyl)guanidine |
| SMILES | CN(/C(N)=N/c1cc(Br)ccc1Br)c1cccc(S(C)=O)c1 |
| InChI | InChI=1S/C15H15Br2N3OS/c1-20(11-4-3-5-12(9-11)22(2)21)15(18)19-14-8-10(16)6-7-13(14)17/h3-9H,1-2H3,(H2,18,19) |
| InChIKey | XWCDNHKHYDXREO-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 58.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.18 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|