C11H13BrN2 — CID 106232839
6-bromo-N-hex-1-yn-3-ylpyridin-2-amine (PubChem CID 106232839) has the molecular formula C11H13BrN2 and a molecular weight of 253.14 g/mol. Its IUPAC name is 6-bromo-N-hex-1-yn-3-ylpyridin-2-amine.
| Compound Name | 6-bromo-N-hex-1-yn-3-ylpyridin-2-amine |
|---|---|
| PubChem CID | 106232839 |
| Molecular Formula | C11H13BrN2 |
| Molecular Weight | 253.14 g/mol |
| Exact Mass | 252.03 |
| IUPAC Name | 6-bromo-N-hex-1-yn-3-ylpyridin-2-amine |
| SMILES | C#CC(CCC)Nc1cccc(Br)n1 |
| InChI | InChI=1S/C11H13BrN2/c1-3-6-9(4-2)13-11-8-5-7-10(12)14-11/h2,5,7-9H,3,6H2,1H3,(H,13,14) |
| InChIKey | JNHHERRNXBRNHO-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.14 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|