C11H20N2O2 — CID 106234456
5-(3,4-dihydro-2H-pyran-2-ylmethylamino)pentanamide (PubChem CID 106234456) has the molecular formula C11H20N2O2 and a molecular weight of 212.29 g/mol. Its IUPAC name is 5-(3,4-dihydro-2H-pyran-2-ylmethylamino)pentanamide.
| Compound Name | 5-(3,4-dihydro-2H-pyran-2-ylmethylamino)pentanamide |
|---|---|
| PubChem CID | 106234456 |
| Molecular Formula | C11H20N2O2 |
| Molecular Weight | 212.29 g/mol |
| Exact Mass | 212.15 |
| IUPAC Name | 5-(3,4-dihydro-2H-pyran-2-ylmethylamino)pentanamide |
| SMILES | NC(=O)CCCCNCC1CCC=CO1 |
| InChI | InChI=1S/C11H20N2O2/c12-11(14)6-1-3-7-13-9-10-5-2-4-8-15-10/h4,8,10,13H,1-3,5-7,9H2,(H2,12,14) |
| InChIKey | HCJXPKVJJBZCIG-UHFFFAOYSA-N |
| XLogP | 0.92 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.29 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|