C8H12FNO2 — CID 126996521
N-(2-fluoroethyl)-3,4-dihydro-2H-pyran-2-carboxamide (PubChem CID 126996521) has the molecular formula C8H12FNO2 and a molecular weight of 173.19 g/mol. Its IUPAC name is N-(2-fluoroethyl)-3,4-dihydro-2H-pyran-2-carboxamide.
| Compound Name | N-(2-fluoroethyl)-3,4-dihydro-2H-pyran-2-carboxamide |
|---|---|
| PubChem CID | 126996521 |
| Molecular Formula | C8H12FNO2 |
| Molecular Weight | 173.19 g/mol |
| Exact Mass | 173.09 |
| IUPAC Name | N-(2-fluoroethyl)-3,4-dihydro-2H-pyran-2-carboxamide |
| SMILES | O=C(NCCF)C1CCC=CO1 |
| InChI | InChI=1S/C8H12FNO2/c9-4-5-10-8(11)7-3-1-2-6-12-7/h2,6-7H,1,3-5H2,(H,10,11) |
| InChIKey | GEBROSAKIYKYCE-UHFFFAOYSA-N |
| XLogP | 0.76 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 173.19 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |