C9H13NO2 — CID 130635445
N-prop-2-enyl-3,4-dihydro-2H-pyran-2-carboxamide (PubChem CID 130635445) has the molecular formula C9H13NO2 and a molecular weight of 167.21 g/mol. Its IUPAC name is N-prop-2-enyl-3,4-dihydro-2H-pyran-2-carboxamide.
| Compound Name | N-prop-2-enyl-3,4-dihydro-2H-pyran-2-carboxamide |
|---|---|
| PubChem CID | 130635445 |
| Molecular Formula | C9H13NO2 |
| Molecular Weight | 167.21 g/mol |
| Exact Mass | 167.09 |
| IUPAC Name | N-prop-2-enyl-3,4-dihydro-2H-pyran-2-carboxamide |
| SMILES | C=CCNC(=O)C1CCC=CO1 |
| InChI | InChI=1S/C9H13NO2/c1-2-6-10-9(11)8-5-3-4-7-12-8/h2,4,7-8H,1,3,5-6H2,(H,10,11) |
| InChIKey | FSFVXPZLFGNXKF-UHFFFAOYSA-N |
| XLogP | 0.98 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 167.21 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|