C9H15NO2 — CID 127012090
N-propan-2-yl-3,4-dihydro-2H-pyran-2-carboxamide (PubChem CID 127012090) has the molecular formula C9H15NO2 and a molecular weight of 169.22 g/mol. Its IUPAC name is N-propan-2-yl-3,4-dihydro-2H-pyran-2-carboxamide.
| Compound Name | N-propan-2-yl-3,4-dihydro-2H-pyran-2-carboxamide |
|---|---|
| PubChem CID | 127012090 |
| Molecular Formula | C9H15NO2 |
| Molecular Weight | 169.22 g/mol |
| Exact Mass | 169.11 |
| IUPAC Name | N-propan-2-yl-3,4-dihydro-2H-pyran-2-carboxamide |
| SMILES | CC(C)NC(=O)C1CCC=CO1 |
| InChI | InChI=1S/C9H15NO2/c1-7(2)10-9(11)8-5-3-4-6-12-8/h4,6-8H,3,5H2,1-2H3,(H,10,11) |
| InChIKey | MVZMNQLTCGYORX-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 169.22 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |