C16H24NO4S+ — CID 10623541
[(2S,3R)-3-acetamido-4-acetyloxy-1-methoxybutan-2-yl]-methyl-phenylsulfanium (PubChem CID 10623541) has the molecular formula C16H24NO4S+ and a molecular weight of 326.44 g/mol. Its IUPAC name is [(2S,3R)-3-acetamido-4-acetyloxy-1-methoxybutan-2-yl]-methyl-phenylsulfanium.
| Compound Name | [(2S,3R)-3-acetamido-4-acetyloxy-1-methoxybutan-2-yl]-methyl-phenylsulfanium |
|---|---|
| PubChem CID | 10623541 |
| Molecular Formula | C16H24NO4S+ |
| Molecular Weight | 326.44 g/mol |
| Exact Mass | 326.14 |
| IUPAC Name | [(2S,3R)-3-acetamido-4-acetyloxy-1-methoxybutan-2-yl]-methyl-phenylsulfanium |
| SMILES | COC[C@H]([C@@H](COC(C)=O)NC(C)=O)[S+](C)c1ccccc1 |
| InChI | InChI=1S/C16H23NO4S/c1-12(18)17-15(10-21-13(2)19)16(11-20-3)22(4)14-8-6-5-7-9-14/h5-9,15-16H,10-11H2,1-4H3/p+1/t15-,16-,22?/m1/s1 |
| InChIKey | UUWYMSBSNFMNIA-AXJGWOQESA-O |
| XLogP | 1.38 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.44 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|