C12H18N4O4 — CID 106237962
5-[2-(2-amino-2-oxoethoxy)ethylamino]-2-propan-2-ylpyrimidine-4-carboxylic acid (PubChem CID 106237962) has the molecular formula C12H18N4O4 and a molecular weight of 282.30 g/mol. Its IUPAC name is 5-[2-(2-amino-2-oxoethoxy)ethylamino]-2-propan-2-ylpyrimidine-4-carboxylic acid.
| Compound Name | 5-[2-(2-amino-2-oxoethoxy)ethylamino]-2-propan-2-ylpyrimidine-4-carboxylic acid |
|---|---|
| PubChem CID | 106237962 |
| Molecular Formula | C12H18N4O4 |
| Molecular Weight | 282.30 g/mol |
| Exact Mass | 282.13 |
| IUPAC Name | 5-[2-(2-amino-2-oxoethoxy)ethylamino]-2-propan-2-ylpyrimidine-4-carboxylic acid |
| SMILES | CC(C)c1ncc(NCCOCC(N)=O)c(C(=O)O)n1 |
| InChI | InChI=1S/C12H18N4O4/c1-7(2)11-15-5-8(10(16-11)12(18)19)14-3-4-20-6-9(13)17/h5,7,14H,3-4,6H2,1-2H3,(H2,13,17)(H,18,19) |
| InChIKey | KKXZQSVPJQVVFF-UHFFFAOYSA-N |
| XLogP | 0.21 |
| TPSA | 127.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.30 |
| LogP ≤ 5 | 0.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|