C14H22N4O3 — CID 62087587
5-[[3-oxo-3-(propylamino)propyl]amino]-2-propan-2-ylpyrimidine-4-carboxylic acid (PubChem CID 62087587) has the molecular formula C14H22N4O3 and a molecular weight of 294.35 g/mol. Its IUPAC name is 5-[[3-oxo-3-(propylamino)propyl]amino]-2-propan-2-ylpyrimidine-4-carboxylic acid.
| Compound Name | 5-[[3-oxo-3-(propylamino)propyl]amino]-2-propan-2-ylpyrimidine-4-carboxylic acid |
|---|---|
| PubChem CID | 62087587 |
| Molecular Formula | C14H22N4O3 |
| Molecular Weight | 294.35 g/mol |
| Exact Mass | 294.17 |
| IUPAC Name | 5-[[3-oxo-3-(propylamino)propyl]amino]-2-propan-2-ylpyrimidine-4-carboxylic acid |
| SMILES | CCCNC(=O)CCNc1cnc(C(C)C)nc1C(=O)O |
| InChI | InChI=1S/C14H22N4O3/c1-4-6-16-11(19)5-7-15-10-8-17-13(9(2)3)18-12(10)14(20)21/h8-9,15H,4-7H2,1-3H3,(H,16,19)(H,20,21) |
| InChIKey | HZBNPHPLCFHHGU-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 104.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.35 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |