C15H27N3O5 — CID 106238329
2-[3-[(5-amino-5-oxopentyl)amino]-1-[(2-methylpropan-2-yl)oxycarbonyl]azetidin-3-yl]acetic acid (PubChem CID 106238329) has the molecular formula C15H27N3O5 and a molecular weight of 329.40 g/mol. Its IUPAC name is 2-[3-[(5-amino-5-oxopentyl)amino]-1-[(2-methylpropan-2-yl)oxycarbonyl]azetidin-3-yl]acetic acid.
| Compound Name | 2-[3-[(5-amino-5-oxopentyl)amino]-1-[(2-methylpropan-2-yl)oxycarbonyl]azetidin-3-yl]acetic acid |
|---|---|
| PubChem CID | 106238329 |
| Molecular Formula | C15H27N3O5 |
| Molecular Weight | 329.40 g/mol |
| Exact Mass | 329.20 |
| IUPAC Name | 2-[3-[(5-amino-5-oxopentyl)amino]-1-[(2-methylpropan-2-yl)oxycarbonyl]azetidin-3-yl]acetic acid |
| SMILES | CC(C)(C)OC(=O)N1CC(CC(=O)O)(NCCCCC(N)=O)C1 |
| InChI | InChI=1S/C15H27N3O5/c1-14(2,3)23-13(22)18-9-15(10-18,8-12(20)21)17-7-5-4-6-11(16)19/h17H,4-10H2,1-3H3,(H2,16,19)(H,20,21) |
| InChIKey | GZSDGEFQPREDBD-UHFFFAOYSA-N |
| XLogP | 0.70 |
| TPSA | 121.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.40 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|