C16H28N2O5 — CID 107143208
2-[1-[(2-methylpropan-2-yl)oxycarbonyl]-3-[2-(2-methylprop-2-enoxy)ethylamino]azetidin-3-yl]acetic acid (PubChem CID 107143208) has the molecular formula C16H28N2O5 and a molecular weight of 328.41 g/mol. Its IUPAC name is 2-[1-[(2-methylpropan-2-yl)oxycarbonyl]-3-[2-(2-methylprop-2-enoxy)ethylamino]azetidin-3-yl]acetic acid.
| Compound Name | 2-[1-[(2-methylpropan-2-yl)oxycarbonyl]-3-[2-(2-methylprop-2-enoxy)ethylamino]azetidin-3-yl]acetic acid |
|---|---|
| PubChem CID | 107143208 |
| Molecular Formula | C16H28N2O5 |
| Molecular Weight | 328.41 g/mol |
| Exact Mass | 328.20 |
| IUPAC Name | 2-[1-[(2-methylpropan-2-yl)oxycarbonyl]-3-[2-(2-methylprop-2-enoxy)ethylamino]azetidin-3-yl]acetic acid |
| SMILES | C=C(C)COCCNC1(CC(=O)O)CN(C(=O)OC(C)(C)C)C1 |
| InChI | InChI=1S/C16H28N2O5/c1-12(2)9-22-7-6-17-16(8-13(19)20)10-18(11-16)14(21)23-15(3,4)5/h17H,1,6-11H2,2-5H3,(H,19,20) |
| InChIKey | WPEHRHGCSNGPOZ-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 88.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.41 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|