C14H26N4O3 — CID 106238613
tert-butyl 6-[(5-amino-5-oxopentyl)amino]-3,5-dihydro-2H-pyrazine-4-carboxylate (PubChem CID 106238613) has the molecular formula C14H26N4O3 and a molecular weight of 298.39 g/mol. Its IUPAC name is tert-butyl 6-[(5-amino-5-oxopentyl)amino]-3,5-dihydro-2H-pyrazine-4-carboxylate.
| Compound Name | tert-butyl 6-[(5-amino-5-oxopentyl)amino]-3,5-dihydro-2H-pyrazine-4-carboxylate |
|---|---|
| PubChem CID | 106238613 |
| Molecular Formula | C14H26N4O3 |
| Molecular Weight | 298.39 g/mol |
| Exact Mass | 298.20 |
| IUPAC Name | tert-butyl 6-[(5-amino-5-oxopentyl)amino]-3,5-dihydro-2H-pyrazine-4-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCN=C(NCCCCC(N)=O)C1 |
| InChI | InChI=1S/C14H26N4O3/c1-14(2,3)21-13(20)18-9-8-17-12(10-18)16-7-5-4-6-11(15)19/h4-10H2,1-3H3,(H2,15,19)(H,16,17) |
| InChIKey | DTZONBXQHAMSFB-UHFFFAOYSA-N |
| XLogP | 0.88 |
| TPSA | 97.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.39 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|