C16H31N5O3 — CID 90995947
tert-butyl 4-[5-[(N'-methylcarbamimidoyl)amino]pentanoyl]piperazine-1-carboxylate (PubChem CID 90995947) has the molecular formula C16H31N5O3 and a molecular weight of 341.46 g/mol. Its IUPAC name is tert-butyl 4-[5-[(N'-methylcarbamimidoyl)amino]pentanoyl]piperazine-1-carboxylate.
| Compound Name | tert-butyl 4-[5-[(N'-methylcarbamimidoyl)amino]pentanoyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 90995947 |
| Molecular Formula | C16H31N5O3 |
| Molecular Weight | 341.46 g/mol |
| Exact Mass | 341.24 |
| IUPAC Name | tert-butyl 4-[5-[(N'-methylcarbamimidoyl)amino]pentanoyl]piperazine-1-carboxylate |
| SMILES | C/N=C(\N)NCCCCC(=O)N1CCN(C(=O)OC(C)(C)C)CC1 |
| InChI | InChI=1S/C16H31N5O3/c1-16(2,3)24-15(23)21-11-9-20(10-12-21)13(22)7-5-6-8-19-14(17)18-4/h5-12H2,1-4H3,(H3,17,18,19) |
| InChIKey | LCAUOTSMJLGLGF-UHFFFAOYSA-N |
| XLogP | 0.77 |
| TPSA | 100.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.46 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|