C12H24N4O2 — CID 166880593
tert-butyl (3S)-3-[(N'-methylcarbamimidoyl)amino]piperidine-1-carboxylate (PubChem CID 166880593) has the molecular formula C12H24N4O2 and a molecular weight of 256.35 g/mol. Its IUPAC name is tert-butyl (3S)-3-[(N'-methylcarbamimidoyl)amino]piperidine-1-carboxylate.
| Compound Name | tert-butyl (3S)-3-[(N'-methylcarbamimidoyl)amino]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 166880593 |
| Molecular Formula | C12H24N4O2 |
| Molecular Weight | 256.35 g/mol |
| Exact Mass | 256.19 |
| IUPAC Name | tert-butyl (3S)-3-[(N'-methylcarbamimidoyl)amino]piperidine-1-carboxylate |
| SMILES | C/N=C(\N)N[C@H]1CCCN(C(=O)OC(C)(C)C)C1 |
| InChI | InChI=1S/C12H24N4O2/c1-12(2,3)18-11(17)16-7-5-6-9(8-16)15-10(13)14-4/h9H,5-8H2,1-4H3,(H3,13,14,15)/t9-/m0/s1 |
| InChIKey | NPSCXRRTUXKPMZ-VIFPVBQESA-N |
| XLogP | 0.92 |
| TPSA | 79.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.35 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|