C11H22N4O2 — CID 91991804
tert-butyl N-(1-carbamimidoylpiperidin-3-yl)carbamate (PubChem CID 91991804) has the molecular formula C11H22N4O2 and a molecular weight of 242.32 g/mol. Its IUPAC name is tert-butyl N-(1-carbamimidoylpiperidin-3-yl)carbamate.
| Compound Name | tert-butyl N-(1-carbamimidoylpiperidin-3-yl)carbamate |
|---|---|
| PubChem CID | 91991804 |
| Molecular Formula | C11H22N4O2 |
| Molecular Weight | 242.32 g/mol |
| Exact Mass | 242.17 |
| IUPAC Name | tert-butyl N-(1-carbamimidoylpiperidin-3-yl)carbamate |
| SMILES | [H]/N=C(\N)N1CCCC(NC(=O)OC(C)(C)C)C1 |
| InChI | InChI=1S/C11H22N4O2/c1-11(2,3)17-10(16)14-8-5-4-6-15(7-8)9(12)13/h8H,4-7H2,1-3H3,(H3,12,13)(H,14,16) |
| InChIKey | YIGMSJYDEVDGRN-UHFFFAOYSA-N |
| XLogP | 0.87 |
| TPSA | 91.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.32 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|