C12H17N5O — CID 106239996
5-(2-amino-5-methylimidazo[4,5-b]pyridin-3-yl)pentanamide (PubChem CID 106239996) has the molecular formula C12H17N5O and a molecular weight of 247.30 g/mol. Its IUPAC name is 5-(2-amino-5-methylimidazo[4,5-b]pyridin-3-yl)pentanamide.
| Compound Name | 5-(2-amino-5-methylimidazo[4,5-b]pyridin-3-yl)pentanamide |
|---|---|
| PubChem CID | 106239996 |
| Molecular Formula | C12H17N5O |
| Molecular Weight | 247.30 g/mol |
| Exact Mass | 247.14 |
| IUPAC Name | 5-(2-amino-5-methylimidazo[4,5-b]pyridin-3-yl)pentanamide |
| SMILES | Cc1ccc2nc(N)n(CCCCC(N)=O)c2n1 |
| InChI | InChI=1S/C12H17N5O/c1-8-5-6-9-11(15-8)17(12(14)16-9)7-3-2-4-10(13)18/h5-6H,2-4,7H2,1H3,(H2,13,18)(H2,14,16) |
| InChIKey | DMYYTVHFNKDATF-UHFFFAOYSA-N |
| XLogP | 0.98 |
| TPSA | 99.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.30 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|