About 5-methyl-3-[(3-methyl-1,2-oxazol-5-yl)methyl]imidazo[4,5-b]pyridin-2-amine
5-methyl-3-[(3-methyl-1,2-oxazol-5-yl)methyl]imidazo[4,5-b]pyridin-2-amine (PubChem CID 81135716) has the molecular formula C12H13N5O
and a molecular weight of 243.27 g/mol. Its IUPAC name is 5-methyl-3-[(3-methyl-1,2-oxazol-5-yl)methyl]imidazo[4,5-b]pyridin-2-amine.
Molecular Properties
| Compound Name | 5-methyl-3-[(3-methyl-1,2-oxazol-5-yl)methyl]imidazo[4,5-b]pyridin-2-amine |
| PubChem CID | 81135716 |
| Molecular Formula | C12H13N5O |
| Molecular Weight | 243.27 g/mol |
| Exact Mass | 243.11 |
| IUPAC Name | 5-methyl-3-[(3-methyl-1,2-oxazol-5-yl)methyl]imidazo[4,5-b]pyridin-2-amine |
| SMILES | Cc1cc(Cn2c(N)nc3ccc(C)nc32)on1 |
| InChI | InChI=1S/C12H13N5O/c1-7-3-4-10-11(14-7)17(12(13)15-10)6-9-5-8(2)16-18-9/h3-5H,6H2,1-2H3,(H2,13,15) |
| InChIKey | RTHHWWYFRFCVPZ-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 82.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 243.27 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 5-methyl-3-[(3-methyl-1,2-oxazol-5-yl)methyl]imidazo[4,5-b]pyridin-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-methyl-3-[(3-methyl-1,2-oxazol-5-yl)methyl]imidazo[4,5-b]pyridin-2-amine?
The IUPAC name of 5-methyl-3-[(3-methyl-1,2-oxazol-5-yl)methyl]imidazo[4,5-b]pyridin-2-amine (CID 81135716) is 5-methyl-3-[(3-methyl-1,2-oxazol-5-yl)methyl]imidazo[4,5-b]pyridin-2-amine.
What is the SMILES notation for 5-methyl-3-[(3-methyl-1,2-oxazol-5-yl)methyl]imidazo[4,5-b]pyridin-2-amine?
The canonical SMILES for 5-methyl-3-[(3-methyl-1,2-oxazol-5-yl)methyl]imidazo[4,5-b]pyridin-2-amine is Cc1cc(Cn2c(N)nc3ccc(C)nc32)on1.
What is the InChIKey of 5-methyl-3-[(3-methyl-1,2-oxazol-5-yl)methyl]imidazo[4,5-b]pyridin-2-amine?
The InChIKey is RTHHWWYFRFCVPZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H13N5O/c1-7-3-4-10-11(14-7)17(12(13)15-10)6-9-5-8(2)16-18-9/h3-5H,6H2,1-2H3,(H2,13,15).
What are the key properties of 5-methyl-3-[(3-methyl-1,2-oxazol-5-yl)methyl]imidazo[4,5-b]pyridin-2-amine?
5-methyl-3-[(3-methyl-1,2-oxazol-5-yl)methyl]imidazo[4,5-b]pyridin-2-amine has a molecular weight of 243.27 g/mol, XLogP of 1.67, 2 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 5-methyl-3-[(3-methyl-1,2-oxazol-5-yl)methyl]imidazo[4,5-b]pyridin-2-amine is sourced from PubChem (CID 81135716), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).