C12H23N3O3 — CID 106241354
2-amino-N-[2-(2-amino-2-oxoethoxy)ethyl]-3-methylcyclohexane-1-carboxamide (PubChem CID 106241354) has the molecular formula C12H23N3O3 and a molecular weight of 257.33 g/mol. Its IUPAC name is 2-amino-N-[2-(2-amino-2-oxoethoxy)ethyl]-3-methylcyclohexane-1-carboxamide.
| Compound Name | 2-amino-N-[2-(2-amino-2-oxoethoxy)ethyl]-3-methylcyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 106241354 |
| Molecular Formula | C12H23N3O3 |
| Molecular Weight | 257.33 g/mol |
| Exact Mass | 257.17 |
| IUPAC Name | 2-amino-N-[2-(2-amino-2-oxoethoxy)ethyl]-3-methylcyclohexane-1-carboxamide |
| SMILES | CC1CCCC(C(=O)NCCOCC(N)=O)C1N |
| InChI | InChI=1S/C12H23N3O3/c1-8-3-2-4-9(11(8)14)12(17)15-5-6-18-7-10(13)16/h8-9,11H,2-7,14H2,1H3,(H2,13,16)(H,15,17) |
| InChIKey | UEXVSFRMFGRFCN-UHFFFAOYSA-N |
| XLogP | -0.63 |
| TPSA | 107.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.33 |
| LogP ≤ 5 | -0.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|