C9H14N2O5 — CID 106234746
cis-(1S,2R)-2-[2-(2-amino-2-oxoethoxy)ethylcarbamoyl]cyclopropane-1-carboxylic acid (PubChem CID 106234746) has the molecular formula C9H14N2O5 and a molecular weight of 230.22 g/mol. Its IUPAC name is cis-(1S,2R)-2-[2-(2-amino-2-oxoethoxy)ethylcarbamoyl]cyclopropane-1-carboxylic acid.
| Compound Name | cis-(1S,2R)-2-[2-(2-amino-2-oxoethoxy)ethylcarbamoyl]cyclopropane-1-carboxylic acid |
|---|---|
| PubChem CID | 106234746 |
| Molecular Formula | C9H14N2O5 |
| Molecular Weight | 230.22 g/mol |
| Exact Mass | 230.09 |
| IUPAC Name | cis-(1S,2R)-2-[2-(2-amino-2-oxoethoxy)ethylcarbamoyl]cyclopropane-1-carboxylic acid |
| SMILES | NC(=O)COCCNC(=O)[C@@H]1C[C@@H]1C(=O)O |
| InChI | InChI=1S/C9H14N2O5/c10-7(12)4-16-2-1-11-8(13)5-3-6(5)9(14)15/h5-6H,1-4H2,(H2,10,12)(H,11,13)(H,14,15)/t5-,6+/m1/s1 |
| InChIKey | IFBVTFPBCVPDPV-RITPCOANSA-N |
| XLogP | -1.67 |
| TPSA | 118.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.22 |
| LogP ≤ 5 | -1.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|