C10H16N2O6 — CID 106234765
5-[2-(2-amino-2-oxoethoxy)ethylcarbamoyl]oxolane-2-carboxylic acid (PubChem CID 106234765) has the molecular formula C10H16N2O6 and a molecular weight of 260.25 g/mol. Its IUPAC name is 5-[2-(2-amino-2-oxoethoxy)ethylcarbamoyl]oxolane-2-carboxylic acid.
| Compound Name | 5-[2-(2-amino-2-oxoethoxy)ethylcarbamoyl]oxolane-2-carboxylic acid |
|---|---|
| PubChem CID | 106234765 |
| Molecular Formula | C10H16N2O6 |
| Molecular Weight | 260.25 g/mol |
| Exact Mass | 260.10 |
| IUPAC Name | 5-[2-(2-amino-2-oxoethoxy)ethylcarbamoyl]oxolane-2-carboxylic acid |
| SMILES | NC(=O)COCCNC(=O)C1CCC(C(=O)O)O1 |
| InChI | InChI=1S/C10H16N2O6/c11-8(13)5-17-4-3-12-9(14)6-1-2-7(18-6)10(15)16/h6-7H,1-5H2,(H2,11,13)(H,12,14)(H,15,16) |
| InChIKey | SPFUXWWZNONPIE-UHFFFAOYSA-N |
| XLogP | -1.76 |
| TPSA | 127.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.25 |
| LogP ≤ 5 | -1.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|