C10H15F2NO5 — CID 103090704
5-[2-(2,2-difluoroethoxy)ethylcarbamoyl]oxolane-2-carboxylic acid (PubChem CID 103090704) has the molecular formula C10H15F2NO5 and a molecular weight of 267.23 g/mol. Its IUPAC name is 5-[2-(2,2-difluoroethoxy)ethylcarbamoyl]oxolane-2-carboxylic acid.
| Compound Name | 5-[2-(2,2-difluoroethoxy)ethylcarbamoyl]oxolane-2-carboxylic acid |
|---|---|
| PubChem CID | 103090704 |
| Molecular Formula | C10H15F2NO5 |
| Molecular Weight | 267.23 g/mol |
| Exact Mass | 267.09 |
| IUPAC Name | 5-[2-(2,2-difluoroethoxy)ethylcarbamoyl]oxolane-2-carboxylic acid |
| SMILES | O=C(O)C1CCC(C(=O)NCCOCC(F)F)O1 |
| InChI | InChI=1S/C10H15F2NO5/c11-8(12)5-17-4-3-13-9(14)6-1-2-7(18-6)10(15)16/h6-8H,1-5H2,(H,13,14)(H,15,16) |
| InChIKey | FXLNGPQEWHFKOD-UHFFFAOYSA-N |
| XLogP | 0.02 |
| TPSA | 84.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.23 |
| LogP ≤ 5 | 0.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|