C13H23N7O — CID 106241670
5-[[4-(methylamino)-6-pyrrolidin-1-yl-1,3,5-triazin-2-yl]amino]pentanamide (PubChem CID 106241670) has the molecular formula C13H23N7O and a molecular weight of 293.37 g/mol. Its IUPAC name is 5-[[4-(methylamino)-6-pyrrolidin-1-yl-1,3,5-triazin-2-yl]amino]pentanamide.
| Compound Name | 5-[[4-(methylamino)-6-pyrrolidin-1-yl-1,3,5-triazin-2-yl]amino]pentanamide |
|---|---|
| PubChem CID | 106241670 |
| Molecular Formula | C13H23N7O |
| Molecular Weight | 293.37 g/mol |
| Exact Mass | 293.20 |
| IUPAC Name | 5-[[4-(methylamino)-6-pyrrolidin-1-yl-1,3,5-triazin-2-yl]amino]pentanamide |
| SMILES | CNc1nc(NCCCCC(N)=O)nc(N2CCCC2)n1 |
| InChI | InChI=1S/C13H23N7O/c1-15-11-17-12(16-7-3-2-6-10(14)21)19-13(18-11)20-8-4-5-9-20/h2-9H2,1H3,(H2,14,21)(H2,15,16,17,18,19) |
| InChIKey | CRFMOLRAXDAWDJ-UHFFFAOYSA-N |
| XLogP | 0.58 |
| TPSA | 109.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.37 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|