C11H25ClN2O — CID 106242456
N-(3-chloro-4-methoxybutyl)-N',N'-diethylethane-1,2-diamine (PubChem CID 106242456) has the molecular formula C11H25ClN2O and a molecular weight of 236.79 g/mol. Its IUPAC name is N-(3-chloro-4-methoxybutyl)-N',N'-diethylethane-1,2-diamine.
| Compound Name | N-(3-chloro-4-methoxybutyl)-N',N'-diethylethane-1,2-diamine |
|---|---|
| PubChem CID | 106242456 |
| Molecular Formula | C11H25ClN2O |
| Molecular Weight | 236.79 g/mol |
| Exact Mass | 236.17 |
| IUPAC Name | N-(3-chloro-4-methoxybutyl)-N',N'-diethylethane-1,2-diamine |
| SMILES | CCN(CC)CCNCCC(Cl)COC |
| InChI | InChI=1S/C11H25ClN2O/c1-4-14(5-2)9-8-13-7-6-11(12)10-15-3/h11,13H,4-10H2,1-3H3 |
| InChIKey | FHKXJGFUMTXOSV-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.79 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|