C11H25ClN2O — CID 107913644
N-(2-chloro-3-methoxypropyl)-N',N'-diethyl-N-methylethane-1,2-diamine (PubChem CID 107913644) has the molecular formula C11H25ClN2O and a molecular weight of 236.79 g/mol. Its IUPAC name is N-(2-chloro-3-methoxypropyl)-N',N'-diethyl-N-methylethane-1,2-diamine.
| Compound Name | N-(2-chloro-3-methoxypropyl)-N',N'-diethyl-N-methylethane-1,2-diamine |
|---|---|
| PubChem CID | 107913644 |
| Molecular Formula | C11H25ClN2O |
| Molecular Weight | 236.79 g/mol |
| Exact Mass | 236.17 |
| IUPAC Name | N-(2-chloro-3-methoxypropyl)-N',N'-diethyl-N-methylethane-1,2-diamine |
| SMILES | CCN(CC)CCN(C)CC(Cl)COC |
| InChI | InChI=1S/C11H25ClN2O/c1-5-14(6-2)8-7-13(3)9-11(12)10-15-4/h11H,5-10H2,1-4H3 |
| InChIKey | OFWFMYGBMJCBNF-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 15.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.79 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|