C9H18ClNO4S — CID 106243933
N-(3-chloro-4-methoxybutyl)-2-methylsulfonylpropanamide (PubChem CID 106243933) has the molecular formula C9H18ClNO4S and a molecular weight of 271.77 g/mol. Its IUPAC name is N-(3-chloro-4-methoxybutyl)-2-methylsulfonylpropanamide.
| Compound Name | N-(3-chloro-4-methoxybutyl)-2-methylsulfonylpropanamide |
|---|---|
| PubChem CID | 106243933 |
| Molecular Formula | C9H18ClNO4S |
| Molecular Weight | 271.77 g/mol |
| Exact Mass | 271.06 |
| IUPAC Name | N-(3-chloro-4-methoxybutyl)-2-methylsulfonylpropanamide |
| SMILES | COCC(Cl)CCNC(=O)C(C)S(C)(=O)=O |
| InChI | InChI=1S/C9H18ClNO4S/c1-7(16(3,13)14)9(12)11-5-4-8(10)6-15-2/h7-8H,4-6H2,1-3H3,(H,11,12) |
| InChIKey | DYOGHYLMXFOJGM-UHFFFAOYSA-N |
| XLogP | 0.18 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.77 |
| LogP ≤ 5 | 0.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|