C11H21NO4S — CID 106244340
5-[(2-hydroxy-2-methyl-3-methylsulfanylpropyl)amino]-3-methyl-5-oxopentanoic acid (PubChem CID 106244340) has the molecular formula C11H21NO4S and a molecular weight of 263.36 g/mol. Its IUPAC name is 5-[(2-hydroxy-2-methyl-3-methylsulfanylpropyl)amino]-3-methyl-5-oxopentanoic acid.
| Compound Name | 5-[(2-hydroxy-2-methyl-3-methylsulfanylpropyl)amino]-3-methyl-5-oxopentanoic acid |
|---|---|
| PubChem CID | 106244340 |
| Molecular Formula | C11H21NO4S |
| Molecular Weight | 263.36 g/mol |
| Exact Mass | 263.12 |
| IUPAC Name | 5-[(2-hydroxy-2-methyl-3-methylsulfanylpropyl)amino]-3-methyl-5-oxopentanoic acid |
| SMILES | CSCC(C)(O)CNC(=O)CC(C)CC(=O)O |
| InChI | InChI=1S/C11H21NO4S/c1-8(5-10(14)15)4-9(13)12-6-11(2,16)7-17-3/h8,16H,4-7H2,1-3H3,(H,12,13)(H,14,15) |
| InChIKey | ZJQFHCJHDWGHDO-UHFFFAOYSA-N |
| XLogP | 0.72 |
| TPSA | 86.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.36 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |