C11H21NO4 — CID 65108474
5-[(2-hydroxy-2-methylbutyl)amino]-3-methyl-5-oxopentanoic acid (PubChem CID 65108474) has the molecular formula C11H21NO4 and a molecular weight of 231.29 g/mol. Its IUPAC name is 5-[(2-hydroxy-2-methylbutyl)amino]-3-methyl-5-oxopentanoic acid.
| Compound Name | 5-[(2-hydroxy-2-methylbutyl)amino]-3-methyl-5-oxopentanoic acid |
|---|---|
| PubChem CID | 65108474 |
| Molecular Formula | C11H21NO4 |
| Molecular Weight | 231.29 g/mol |
| Exact Mass | 231.15 |
| IUPAC Name | 5-[(2-hydroxy-2-methylbutyl)amino]-3-methyl-5-oxopentanoic acid |
| SMILES | CCC(C)(O)CNC(=O)CC(C)CC(=O)O |
| InChI | InChI=1S/C11H21NO4/c1-4-11(3,16)7-12-9(13)5-8(2)6-10(14)15/h8,16H,4-7H2,1-3H3,(H,12,13)(H,14,15) |
| InChIKey | DJOMWUSLOOETCZ-UHFFFAOYSA-N |
| XLogP | 0.76 |
| TPSA | 86.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.29 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |