C10H19N3O2 — CID 106244935
1-methoxy-4-[1-(1H-pyrazol-5-yl)ethylamino]butan-2-ol (PubChem CID 106244935) has the molecular formula C10H19N3O2 and a molecular weight of 213.28 g/mol. Its IUPAC name is 1-methoxy-4-[1-(1H-pyrazol-5-yl)ethylamino]butan-2-ol.
| Compound Name | 1-methoxy-4-[1-(1H-pyrazol-5-yl)ethylamino]butan-2-ol |
|---|---|
| PubChem CID | 106244935 |
| Molecular Formula | C10H19N3O2 |
| Molecular Weight | 213.28 g/mol |
| Exact Mass | 213.15 |
| IUPAC Name | 1-methoxy-4-[1-(1H-pyrazol-5-yl)ethylamino]butan-2-ol |
| SMILES | COCC(O)CCNC(C)c1ccn[nH]1 |
| InChI | InChI=1S/C10H19N3O2/c1-8(10-4-6-12-13-10)11-5-3-9(14)7-15-2/h4,6,8-9,11,14H,3,5,7H2,1-2H3,(H,12,13) |
| InChIKey | BCXZJMXEUFNBTP-UHFFFAOYSA-N |
| XLogP | 0.46 |
| TPSA | 70.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.28 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |