C9H14F3N3 — CID 115516187
4,4,4-trifluoro-N-[1-(1H-pyrazol-5-yl)ethyl]butan-1-amine (PubChem CID 115516187) has the molecular formula C9H14F3N3 and a molecular weight of 221.23 g/mol. Its IUPAC name is 4,4,4-trifluoro-N-[1-(1H-pyrazol-5-yl)ethyl]butan-1-amine.
| Compound Name | 4,4,4-trifluoro-N-[1-(1H-pyrazol-5-yl)ethyl]butan-1-amine |
|---|---|
| PubChem CID | 115516187 |
| Molecular Formula | C9H14F3N3 |
| Molecular Weight | 221.23 g/mol |
| Exact Mass | 221.11 |
| IUPAC Name | 4,4,4-trifluoro-N-[1-(1H-pyrazol-5-yl)ethyl]butan-1-amine |
| SMILES | CC(NCCCC(F)(F)F)c1ccn[nH]1 |
| InChI | InChI=1S/C9H14F3N3/c1-7(8-3-6-14-15-8)13-5-2-4-9(10,11)12/h3,6-7,13H,2,4-5H2,1H3,(H,14,15) |
| InChIKey | AOCGQXKJBUKCCA-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 40.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.23 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|