C10H19N5O — CID 83116402
1,1-dimethyl-3-[2-[1-(1H-pyrazol-5-yl)ethylamino]ethyl]urea (PubChem CID 83116402) has the molecular formula C10H19N5O and a molecular weight of 225.30 g/mol. Its IUPAC name is 1,1-dimethyl-3-[2-[1-(1H-pyrazol-5-yl)ethylamino]ethyl]urea.
| Compound Name | 1,1-dimethyl-3-[2-[1-(1H-pyrazol-5-yl)ethylamino]ethyl]urea |
|---|---|
| PubChem CID | 83116402 |
| Molecular Formula | C10H19N5O |
| Molecular Weight | 225.30 g/mol |
| Exact Mass | 225.16 |
| IUPAC Name | 1,1-dimethyl-3-[2-[1-(1H-pyrazol-5-yl)ethylamino]ethyl]urea |
| SMILES | CC(NCCNC(=O)N(C)C)c1ccn[nH]1 |
| InChI | InChI=1S/C10H19N5O/c1-8(9-4-5-13-14-9)11-6-7-12-10(16)15(2)3/h4-5,8,11H,6-7H2,1-3H3,(H,12,16)(H,13,14) |
| InChIKey | SEUNOHYDRHXWFD-UHFFFAOYSA-N |
| XLogP | 0.33 |
| TPSA | 73.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.30 |
| LogP ≤ 5 | 0.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|