C15H28N4O2 — CID 107246587
tert-butyl N-methyl-N-[2-methyl-3-[1-(1H-pyrazol-5-yl)ethylamino]propyl]carbamate (PubChem CID 107246587) has the molecular formula C15H28N4O2 and a molecular weight of 296.41 g/mol. Its IUPAC name is tert-butyl N-methyl-N-[2-methyl-3-[1-(1H-pyrazol-5-yl)ethylamino]propyl]carbamate.
| Compound Name | tert-butyl N-methyl-N-[2-methyl-3-[1-(1H-pyrazol-5-yl)ethylamino]propyl]carbamate |
|---|---|
| PubChem CID | 107246587 |
| Molecular Formula | C15H28N4O2 |
| Molecular Weight | 296.41 g/mol |
| Exact Mass | 296.22 |
| IUPAC Name | tert-butyl N-methyl-N-[2-methyl-3-[1-(1H-pyrazol-5-yl)ethylamino]propyl]carbamate |
| SMILES | CC(CNC(C)c1ccn[nH]1)CN(C)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C15H28N4O2/c1-11(9-16-12(2)13-7-8-17-18-13)10-19(6)14(20)21-15(3,4)5/h7-8,11-12,16H,9-10H2,1-6H3,(H,17,18) |
| InChIKey | ALXYLHPMQVGYNX-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 70.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.41 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |