C13H28N2O2S — CID 106247135
2-[(2-hydroxy-2-methyl-3-methylsulfanylpropyl)amino]-N-(2-methylbutan-2-yl)propanamide (PubChem CID 106247135) has the molecular formula C13H28N2O2S and a molecular weight of 276.45 g/mol. Its IUPAC name is 2-[(2-hydroxy-2-methyl-3-methylsulfanylpropyl)amino]-N-(2-methylbutan-2-yl)propanamide.
| Compound Name | 2-[(2-hydroxy-2-methyl-3-methylsulfanylpropyl)amino]-N-(2-methylbutan-2-yl)propanamide |
|---|---|
| PubChem CID | 106247135 |
| Molecular Formula | C13H28N2O2S |
| Molecular Weight | 276.45 g/mol |
| Exact Mass | 276.19 |
| IUPAC Name | 2-[(2-hydroxy-2-methyl-3-methylsulfanylpropyl)amino]-N-(2-methylbutan-2-yl)propanamide |
| SMILES | CCC(C)(C)NC(=O)C(C)NCC(C)(O)CSC |
| InChI | InChI=1S/C13H28N2O2S/c1-7-12(3,4)15-11(16)10(2)14-8-13(5,17)9-18-6/h10,14,17H,7-9H2,1-6H3,(H,15,16) |
| InChIKey | QZLNWUIJZYLJGX-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.45 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |