C9H15N3O4 — CID 106247858
N'-(cyanomethyl)-N-(3-hydroxy-4-methoxybutyl)oxamide (PubChem CID 106247858) has the molecular formula C9H15N3O4 and a molecular weight of 229.24 g/mol. Its IUPAC name is N'-(cyanomethyl)-N-(3-hydroxy-4-methoxybutyl)oxamide.
| Compound Name | N'-(cyanomethyl)-N-(3-hydroxy-4-methoxybutyl)oxamide |
|---|---|
| PubChem CID | 106247858 |
| Molecular Formula | C9H15N3O4 |
| Molecular Weight | 229.24 g/mol |
| Exact Mass | 229.11 |
| IUPAC Name | N'-(cyanomethyl)-N-(3-hydroxy-4-methoxybutyl)oxamide |
| SMILES | COCC(O)CCNC(=O)C(=O)NCC#N |
| InChI | InChI=1S/C9H15N3O4/c1-16-6-7(13)2-4-11-8(14)9(15)12-5-3-10/h7,13H,2,4-6H2,1H3,(H,11,14)(H,12,15) |
| InChIKey | YRMUFZIIEBTUOM-UHFFFAOYSA-N |
| XLogP | -1.86 |
| TPSA | 111.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.24 |
| LogP ≤ 5 | -1.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|