C10H23N3OS — CID 106248114
2-(2-hydroxy-2-methyl-3-methylsulfanylpropyl)-1-(2-methylpropyl)guanidine (PubChem CID 106248114) has the molecular formula C10H23N3OS and a molecular weight of 233.38 g/mol. Its IUPAC name is 2-(2-hydroxy-2-methyl-3-methylsulfanylpropyl)-1-(2-methylpropyl)guanidine.
| Compound Name | 2-(2-hydroxy-2-methyl-3-methylsulfanylpropyl)-1-(2-methylpropyl)guanidine |
|---|---|
| PubChem CID | 106248114 |
| Molecular Formula | C10H23N3OS |
| Molecular Weight | 233.38 g/mol |
| Exact Mass | 233.16 |
| IUPAC Name | 2-(2-hydroxy-2-methyl-3-methylsulfanylpropyl)-1-(2-methylpropyl)guanidine |
| SMILES | CSCC(C)(O)C/N=C(\N)NCC(C)C |
| InChI | InChI=1S/C10H23N3OS/c1-8(2)5-12-9(11)13-6-10(3,14)7-15-4/h8,14H,5-7H2,1-4H3,(H3,11,12,13) |
| InChIKey | IALRWKHMIPJTPX-UHFFFAOYSA-N |
| XLogP | 0.66 |
| TPSA | 70.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.38 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|