C14H26N2O2S — CID 106251005
ethyl 4-[(5,5-diethyl-4,6-dihydro-1,3-thiazin-2-yl)amino]butanoate (PubChem CID 106251005) has the molecular formula C14H26N2O2S and a molecular weight of 286.44 g/mol. Its IUPAC name is ethyl 4-[(5,5-diethyl-4,6-dihydro-1,3-thiazin-2-yl)amino]butanoate.
| Compound Name | ethyl 4-[(5,5-diethyl-4,6-dihydro-1,3-thiazin-2-yl)amino]butanoate |
|---|---|
| PubChem CID | 106251005 |
| Molecular Formula | C14H26N2O2S |
| Molecular Weight | 286.44 g/mol |
| Exact Mass | 286.17 |
| IUPAC Name | ethyl 4-[(5,5-diethyl-4,6-dihydro-1,3-thiazin-2-yl)amino]butanoate |
| SMILES | CCOC(=O)CCCNC1=NCC(CC)(CC)CS1 |
| InChI | InChI=1S/C14H26N2O2S/c1-4-14(5-2)10-16-13(19-11-14)15-9-7-8-12(17)18-6-3/h4-11H2,1-3H3,(H,15,16) |
| InChIKey | HXOWRSRHUCNLDU-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 50.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.44 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|