C19H27F3N2O10 — CID 10625193
(2R,3R,4S,5S,6E)-6-[[3-(trifluoromethyl)phenyl]hydrazinylidene]-5-[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyhexane-1,2,3,4-tetrol (PubChem CID 10625193) has the molecular formula C19H27F3N2O10 and a molecular weight of 500.42 g/mol. Its IUPAC name is (2R,3R,4S,5S,6E)-6-[[3-(trifluoromethyl)phenyl]hydrazinylidene]-5-[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyhexane-1,2,3,4-tetrol.
| Compound Name | (2R,3R,4S,5S,6E)-6-[[3-(trifluoromethyl)phenyl]hydrazinylidene]-5-[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyhexane-1,2,3,4-tetrol |
|---|---|
| PubChem CID | 10625193 |
| Molecular Formula | C19H27F3N2O10 |
| Molecular Weight | 500.42 g/mol |
| Exact Mass | 500.16 |
| IUPAC Name | (2R,3R,4S,5S,6E)-6-[[3-(trifluoromethyl)phenyl]hydrazinylidene]-5-[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyhexane-1,2,3,4-tetrol |
| SMILES | OC[C@@H](O)[C@@H](O)[C@H](O)[C@H](/C=N/Nc1cccc(C(F)(F)F)c1)O[C@@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O |
| InChI | InChI=1S/C19H27F3N2O10/c20-19(21,22)8-2-1-3-9(4-8)24-23-5-11(14(29)13(28)10(27)6-25)33-18-17(32)16(31)15(30)12(7-26)34-18/h1-5,10-18,24-32H,6-7H2/b23-5+/t10-,11+,12-,13-,14-,15-,16+,17-,18-/m1/s1 |
| InChIKey | IVPXJQHLBYTGGF-NVFHNBSVSA-N |
| XLogP | -2.64 |
| TPSA | 204.69 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.42 |
| LogP ≤ 5 | -2.64 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|