About 2-(1-benzothiophen-2-yl)-6,6-diethyl-1,4-oxazepane
2-(1-benzothiophen-2-yl)-6,6-diethyl-1,4-oxazepane (PubChem CID 106253305) has the molecular formula C17H23NOS
and a molecular weight of 289.44 g/mol. Its IUPAC name is 2-(1-benzothiophen-2-yl)-6,6-diethyl-1,4-oxazepane.
Molecular Properties
| Compound Name | 2-(1-benzothiophen-2-yl)-6,6-diethyl-1,4-oxazepane |
| PubChem CID | 106253305 |
| Molecular Formula | C17H23NOS |
| Molecular Weight | 289.44 g/mol |
| Exact Mass | 289.15 |
| IUPAC Name | 2-(1-benzothiophen-2-yl)-6,6-diethyl-1,4-oxazepane |
| SMILES | CCC1(CC)CNCC(c2cc3ccccc3s2)OC1 |
| InChI | InChI=1S/C17H23NOS/c1-3-17(4-2)11-18-10-14(19-12-17)16-9-13-7-5-6-8-15(13)20-16/h5-9,14,18H,3-4,10-12H2,1-2H3 |
| InChIKey | PYLSKHWJPULJFP-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 289.44 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-(1-benzothiophen-2-yl)-6,6-diethyl-1,4-oxazepane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(1-benzothiophen-2-yl)-6,6-diethyl-1,4-oxazepane?
The IUPAC name of 2-(1-benzothiophen-2-yl)-6,6-diethyl-1,4-oxazepane (CID 106253305) is 2-(1-benzothiophen-2-yl)-6,6-diethyl-1,4-oxazepane.
What is the SMILES notation for 2-(1-benzothiophen-2-yl)-6,6-diethyl-1,4-oxazepane?
The canonical SMILES for 2-(1-benzothiophen-2-yl)-6,6-diethyl-1,4-oxazepane is CCC1(CC)CNCC(c2cc3ccccc3s2)OC1.
What is the InChIKey of 2-(1-benzothiophen-2-yl)-6,6-diethyl-1,4-oxazepane?
The InChIKey is PYLSKHWJPULJFP-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H23NOS/c1-3-17(4-2)11-18-10-14(19-12-17)16-9-13-7-5-6-8-15(13)20-16/h5-9,14,18H,3-4,10-12H2,1-2H3.
What are the key properties of 2-(1-benzothiophen-2-yl)-6,6-diethyl-1,4-oxazepane?
2-(1-benzothiophen-2-yl)-6,6-diethyl-1,4-oxazepane has a molecular weight of 289.44 g/mol, XLogP of 4.37, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(1-benzothiophen-2-yl)-6,6-diethyl-1,4-oxazepane is sourced from PubChem (CID 106253305), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).