C13H17FN4O2 — CID 106256785
2-fluoro-N'-hydroxy-3-[[(1-methyl-2-oxopyrrolidin-3-yl)amino]methyl]benzenecarboximidamide (PubChem CID 106256785) has the molecular formula C13H17FN4O2 and a molecular weight of 280.30 g/mol. Its IUPAC name is 2-fluoro-N'-hydroxy-3-[[(1-methyl-2-oxopyrrolidin-3-yl)amino]methyl]benzenecarboximidamide.
| Compound Name | 2-fluoro-N'-hydroxy-3-[[(1-methyl-2-oxopyrrolidin-3-yl)amino]methyl]benzenecarboximidamide |
|---|---|
| PubChem CID | 106256785 |
| Molecular Formula | C13H17FN4O2 |
| Molecular Weight | 280.30 g/mol |
| Exact Mass | 280.13 |
| IUPAC Name | 2-fluoro-N'-hydroxy-3-[[(1-methyl-2-oxopyrrolidin-3-yl)amino]methyl]benzenecarboximidamide |
| SMILES | CN1CCC(NCc2cccc(/C(N)=N/O)c2F)C1=O |
| InChI | InChI=1S/C13H17FN4O2/c1-18-6-5-10(13(18)19)16-7-8-3-2-4-9(11(8)14)12(15)17-20/h2-4,10,16,20H,5-7H2,1H3,(H2,15,17) |
| InChIKey | ZBGWEHOBXNHLRM-UHFFFAOYSA-N |
| XLogP | 0.24 |
| TPSA | 90.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.30 |
| LogP ≤ 5 | 0.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|