C11H19N5O4 — CID 106257823
1-[(2-amino-6-methyl-5-nitropyrimidin-4-yl)amino]-4-methoxy-2-methylbutan-2-ol (PubChem CID 106257823) has the molecular formula C11H19N5O4 and a molecular weight of 285.30 g/mol. Its IUPAC name is 1-[(2-amino-6-methyl-5-nitropyrimidin-4-yl)amino]-4-methoxy-2-methylbutan-2-ol.
| Compound Name | 1-[(2-amino-6-methyl-5-nitropyrimidin-4-yl)amino]-4-methoxy-2-methylbutan-2-ol |
|---|---|
| PubChem CID | 106257823 |
| Molecular Formula | C11H19N5O4 |
| Molecular Weight | 285.30 g/mol |
| Exact Mass | 285.14 |
| IUPAC Name | 1-[(2-amino-6-methyl-5-nitropyrimidin-4-yl)amino]-4-methoxy-2-methylbutan-2-ol |
| SMILES | COCCC(C)(O)CNc1nc(N)nc(C)c1[N+](=O)[O-] |
| InChI | InChI=1S/C11H19N5O4/c1-7-8(16(18)19)9(15-10(12)14-7)13-6-11(2,17)4-5-20-3/h17H,4-6H2,1-3H3,(H3,12,13,14,15) |
| InChIKey | RWSYKPXPNARKIR-UHFFFAOYSA-N |
| XLogP | 0.47 |
| TPSA | 136.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.30 |
| LogP ≤ 5 | 0.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|