C12H21FN4O2 — CID 106258036
1-[[2-(ethylamino)-5-fluoropyrimidin-4-yl]amino]-4-methoxy-2-methylbutan-2-ol (PubChem CID 106258036) has the molecular formula C12H21FN4O2 and a molecular weight of 272.32 g/mol. Its IUPAC name is 1-[[2-(ethylamino)-5-fluoropyrimidin-4-yl]amino]-4-methoxy-2-methylbutan-2-ol.
| Compound Name | 1-[[2-(ethylamino)-5-fluoropyrimidin-4-yl]amino]-4-methoxy-2-methylbutan-2-ol |
|---|---|
| PubChem CID | 106258036 |
| Molecular Formula | C12H21FN4O2 |
| Molecular Weight | 272.32 g/mol |
| Exact Mass | 272.16 |
| IUPAC Name | 1-[[2-(ethylamino)-5-fluoropyrimidin-4-yl]amino]-4-methoxy-2-methylbutan-2-ol |
| SMILES | CCNc1ncc(F)c(NCC(C)(O)CCOC)n1 |
| InChI | InChI=1S/C12H21FN4O2/c1-4-14-11-15-7-9(13)10(17-11)16-8-12(2,18)5-6-19-3/h7,18H,4-6,8H2,1-3H3,(H2,14,15,16,17) |
| InChIKey | LNZIDVLEMVWWSF-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 79.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.32 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |