C13H22N4O3 — CID 106258324
2-ethyl-2-[[[6-(methylamino)-4-nitro-2-pyridinyl]amino]methyl]butan-1-ol (PubChem CID 106258324) has the molecular formula C13H22N4O3 and a molecular weight of 282.34 g/mol. Its IUPAC name is 2-ethyl-2-[[[6-(methylamino)-4-nitro-2-pyridinyl]amino]methyl]butan-1-ol.
| Compound Name | 2-ethyl-2-[[[6-(methylamino)-4-nitro-2-pyridinyl]amino]methyl]butan-1-ol |
|---|---|
| PubChem CID | 106258324 |
| Molecular Formula | C13H22N4O3 |
| Molecular Weight | 282.34 g/mol |
| Exact Mass | 282.17 |
| IUPAC Name | 2-ethyl-2-[[[6-(methylamino)-4-nitro-2-pyridinyl]amino]methyl]butan-1-ol |
| SMILES | CCC(CC)(CO)CNc1cc([N+](=O)[O-])cc(NC)n1 |
| InChI | InChI=1S/C13H22N4O3/c1-4-13(5-2,9-18)8-15-12-7-10(17(19)20)6-11(14-3)16-12/h6-7,18H,4-5,8-9H2,1-3H3,(H2,14,15,16) |
| InChIKey | YSPOIPPPWZYBPE-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 100.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.34 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|