C12H15FN4O2 — CID 106259003
2-amino-4-fluoro-5-[(1-methyl-2-oxopyrrolidin-3-yl)amino]benzamide (PubChem CID 106259003) has the molecular formula C12H15FN4O2 and a molecular weight of 266.28 g/mol. Its IUPAC name is 2-amino-4-fluoro-5-[(1-methyl-2-oxopyrrolidin-3-yl)amino]benzamide.
| Compound Name | 2-amino-4-fluoro-5-[(1-methyl-2-oxopyrrolidin-3-yl)amino]benzamide |
|---|---|
| PubChem CID | 106259003 |
| Molecular Formula | C12H15FN4O2 |
| Molecular Weight | 266.28 g/mol |
| Exact Mass | 266.12 |
| IUPAC Name | 2-amino-4-fluoro-5-[(1-methyl-2-oxopyrrolidin-3-yl)amino]benzamide |
| SMILES | CN1CCC(Nc2cc(C(N)=O)c(N)cc2F)C1=O |
| InChI | InChI=1S/C12H15FN4O2/c1-17-3-2-9(12(17)19)16-10-4-6(11(15)18)8(14)5-7(10)13/h4-5,9,16H,2-3,14H2,1H3,(H2,15,18) |
| InChIKey | DDMDEJIHAIOXDR-UHFFFAOYSA-N |
| XLogP | 0.15 |
| TPSA | 101.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.28 |
| LogP ≤ 5 | 0.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|